About 4-diethoxyphosphoryl-1,2-dimethylbenzene
4-diethoxyphosphoryl-1,2-dimethylbenzene (PubChem CID 10966692) has the molecular formula C12H19O3P
and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-diethoxyphosphoryl-1,2-dimethylbenzene |
| PubChem CID | 10966692 |
| Molecular Formula | C12H19O3P |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-diethoxyphosphoryl-1,2-dimethylbenzene |
| SMILES | CCOP(=O)(OCC)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H19O3P/c1-5-14-16(13,15-6-2)12-8-7-10(3)11(4)9-12/h7-9H,5-6H2,1-4H3 |
| InChIKey | OVDYSUKBHLHBSR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-diethoxyphosphoryl-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-diethoxyphosphoryl-1,2-dimethylbenzene?
The IUPAC name of 4-diethoxyphosphoryl-1,2-dimethylbenzene (CID 10966692) is 4-diethoxyphosphoryl-1,2-dimethylbenzene.
What is the SMILES notation for 4-diethoxyphosphoryl-1,2-dimethylbenzene?
The canonical SMILES for 4-diethoxyphosphoryl-1,2-dimethylbenzene is CCOP(=O)(OCC)c1ccc(C)c(C)c1.
What is the InChIKey of 4-diethoxyphosphoryl-1,2-dimethylbenzene?
The InChIKey is OVDYSUKBHLHBSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O3P/c1-5-14-16(13,15-6-2)12-8-7-10(3)11(4)9-12/h7-9H,5-6H2,1-4H3.
What are the key properties of 4-diethoxyphosphoryl-1,2-dimethylbenzene?
4-diethoxyphosphoryl-1,2-dimethylbenzene has a molecular weight of 242.25 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diethoxyphosphoryl-1,2-dimethylbenzene is sourced from PubChem (CID 10966692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).