C13H22S2 — CID 10966714
2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane (PubChem CID 10966714) has the molecular formula C13H22S2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane.
| Compound Name | 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane |
|---|---|
| PubChem CID | 10966714 |
| Molecular Formula | C13H22S2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane |
| SMILES | C=C/C(C)=C/C1(CC(C)C)SCCCS1 |
| InChI | InChI=1S/C13H22S2/c1-5-12(4)10-13(9-11(2)3)14-7-6-8-15-13/h5,10-11H,1,6-9H2,2-4H3/b12-10+ |
| InChIKey | JYHKQSBJKRVRQL-ZRDIBKRKSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|