About 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane
2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane (PubChem CID 10966714) has the molecular formula C13H22S2
and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane |
| PubChem CID | 10966714 |
| Molecular Formula | C13H22S2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane |
| SMILES | C=C/C(C)=C/C1(CC(C)C)SCCCS1 |
| InChI | InChI=1S/C13H22S2/c1-5-12(4)10-13(9-11(2)3)14-7-6-8-15-13/h5,10-11H,1,6-9H2,2-4H3/b12-10+ |
| InChIKey | JYHKQSBJKRVRQL-ZRDIBKRKSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane?
The IUPAC name of 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane (CID 10966714) is 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane.
What is the SMILES notation for 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane?
The canonical SMILES for 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane is C=C/C(C)=C/C1(CC(C)C)SCCCS1.
What is the InChIKey of 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane?
The InChIKey is JYHKQSBJKRVRQL-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H22S2/c1-5-12(4)10-13(9-11(2)3)14-7-6-8-15-13/h5,10-11H,1,6-9H2,2-4H3/b12-10+.
What are the key properties of 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane?
2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane has a molecular weight of 242.45 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1E)-2-methylbuta-1,3-dienyl]-2-(2-methylpropyl)-1,3-dithiane is sourced from PubChem (CID 10966714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).