About 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol
5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol (PubChem CID 10966749) has the molecular formula C9H10BrNO2
and a molecular weight of 244.09 g/mol. Its IUPAC name is 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol.
Molecular Properties
| Compound Name | 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol |
| PubChem CID | 10966749 |
| Molecular Formula | C9H10BrNO2 |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 242.99 |
| IUPAC Name | 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol |
| SMILES | COc1nc(C)c(Br)c2c1C(O)C2 |
| InChI | InChI=1S/C9H10BrNO2/c1-4-8(10)5-3-6(12)7(5)9(11-4)13-2/h6,12H,3H2,1-2H3 |
| InChIKey | BSHZBPSWZZBRON-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol?
The IUPAC name of 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol (CID 10966749) is 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol.
What is the SMILES notation for 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol?
The canonical SMILES for 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol is COc1nc(C)c(Br)c2c1C(O)C2.
What is the InChIKey of 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol?
The InChIKey is BSHZBPSWZZBRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO2/c1-4-8(10)5-3-6(12)7(5)9(11-4)13-2/h6,12H,3H2,1-2H3.
What are the key properties of 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol?
5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol has a molecular weight of 244.09 g/mol, XLogP of 1.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methoxy-4-methyl-3-azabicyclo[4.2.0]octa-1(6),2,4-trien-8-ol is sourced from PubChem (CID 10966749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).