C16H24O2 — CID 10966868
(8E,12E)-9-methylcyclopentadeca-8,12-diene-1,7-dione (PubChem CID 10966868) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (8E,12E)-9-methylcyclopentadeca-8,12-diene-1,7-dione.
| Compound Name | (8E,12E)-9-methylcyclopentadeca-8,12-diene-1,7-dione |
|---|---|
| PubChem CID | 10966868 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (8E,12E)-9-methylcyclopentadeca-8,12-diene-1,7-dione |
| SMILES | C/C1=C\C(=O)CCCCCC(=O)CC/C=C/CC1 |
| InChI | InChI=1S/C16H24O2/c1-14-9-5-2-3-6-10-15(17)11-7-4-8-12-16(18)13-14/h2-3,13H,4-12H2,1H3/b3-2+,14-13+ |
| InChIKey | KYIDLAYCVPEFGM-MHKLCKLJSA-N |
| XLogP | 4.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|