C16H26O2 — CID 10966934
methyl (4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 10966934) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is methyl (4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10966934 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | methyl (4aR,8aR)-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1=C(C)CC[C@@H]2C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C16H26O2/c1-11-7-8-12-15(2,3)9-6-10-16(12,4)13(11)14(17)18-5/h12H,6-10H2,1-5H3/t12-,16-/m1/s1 |
| InChIKey | NIBBGTHIZDZYQX-MLGOLLRUSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |