C12H18O4S — CID 10967176
3-(2-hydroxy-3-phenoxypropyl)sulfanylpropane-1,2-diol (PubChem CID 10967176) has the molecular formula C12H18O4S and a molecular weight of 258.34 g/mol. Its IUPAC name is 3-(2-hydroxy-3-phenoxypropyl)sulfanylpropane-1,2-diol.
| Compound Name | 3-(2-hydroxy-3-phenoxypropyl)sulfanylpropane-1,2-diol |
|---|---|
| PubChem CID | 10967176 |
| Molecular Formula | C12H18O4S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-(2-hydroxy-3-phenoxypropyl)sulfanylpropane-1,2-diol |
| SMILES | OCC(O)CSCC(O)COc1ccccc1 |
| InChI | InChI=1S/C12H18O4S/c13-6-10(14)8-17-9-11(15)7-16-12-4-2-1-3-5-12/h1-5,10-11,13-15H,6-9H2 |
| InChIKey | OHAUYRFFEHQLRX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |