About 1-phenyl-5H-pyrido[4,3-b]indol-4-ol
1-phenyl-5H-pyrido[4,3-b]indol-4-ol (PubChem CID 10967238) has the molecular formula C17H12N2O
and a molecular weight of 260.30 g/mol. Its IUPAC name is 1-phenyl-5H-pyrido[4,3-b]indol-4-ol.
Molecular Properties
| Compound Name | 1-phenyl-5H-pyrido[4,3-b]indol-4-ol |
| PubChem CID | 10967238 |
| Molecular Formula | C17H12N2O |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 1-phenyl-5H-pyrido[4,3-b]indol-4-ol |
| SMILES | Oc1cnc(-c2ccccc2)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C17H12N2O/c20-14-10-18-16(11-6-2-1-3-7-11)15-12-8-4-5-9-13(12)19-17(14)15/h1-10,19-20H |
| InChIKey | JAOGACONLGYOHL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-5H-pyrido[4,3-b]indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-5H-pyrido[4,3-b]indol-4-ol?
The IUPAC name of 1-phenyl-5H-pyrido[4,3-b]indol-4-ol (CID 10967238) is 1-phenyl-5H-pyrido[4,3-b]indol-4-ol.
What is the SMILES notation for 1-phenyl-5H-pyrido[4,3-b]indol-4-ol?
The canonical SMILES for 1-phenyl-5H-pyrido[4,3-b]indol-4-ol is Oc1cnc(-c2ccccc2)c2c1[nH]c1ccccc12.
What is the InChIKey of 1-phenyl-5H-pyrido[4,3-b]indol-4-ol?
The InChIKey is JAOGACONLGYOHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2O/c20-14-10-18-16(11-6-2-1-3-7-11)15-12-8-4-5-9-13(12)19-17(14)15/h1-10,19-20H.
What are the key properties of 1-phenyl-5H-pyrido[4,3-b]indol-4-ol?
1-phenyl-5H-pyrido[4,3-b]indol-4-ol has a molecular weight of 260.30 g/mol, XLogP of 4.09, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-5H-pyrido[4,3-b]indol-4-ol is sourced from PubChem (CID 10967238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).