About (2-chloro-3-pyridinyl) trifluoromethanesulfonate
(2-chloro-3-pyridinyl) trifluoromethanesulfonate (PubChem CID 10967281) has the molecular formula C6H3ClF3NO3S
and a molecular weight of 261.61 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl) trifluoromethanesulfonate.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl) trifluoromethanesulfonate |
| PubChem CID | 10967281 |
| Molecular Formula | C6H3ClF3NO3S |
| Molecular Weight | 261.61 g/mol |
| Exact Mass | 260.95 |
| IUPAC Name | (2-chloro-3-pyridinyl) trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1cccnc1Cl)C(F)(F)F |
| InChI | InChI=1S/C6H3ClF3NO3S/c7-5-4(2-1-3-11-5)14-15(12,13)6(8,9)10/h1-3H |
| InChIKey | JTTBBJHEABJWRL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.61 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl) trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl) trifluoromethanesulfonate?
The IUPAC name of (2-chloro-3-pyridinyl) trifluoromethanesulfonate (CID 10967281) is (2-chloro-3-pyridinyl) trifluoromethanesulfonate.
What is the SMILES notation for (2-chloro-3-pyridinyl) trifluoromethanesulfonate?
The canonical SMILES for (2-chloro-3-pyridinyl) trifluoromethanesulfonate is O=S(=O)(Oc1cccnc1Cl)C(F)(F)F.
What is the InChIKey of (2-chloro-3-pyridinyl) trifluoromethanesulfonate?
The InChIKey is JTTBBJHEABJWRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClF3NO3S/c7-5-4(2-1-3-11-5)14-15(12,13)6(8,9)10/h1-3H.
What are the key properties of (2-chloro-3-pyridinyl) trifluoromethanesulfonate?
(2-chloro-3-pyridinyl) trifluoromethanesulfonate has a molecular weight of 261.61 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl) trifluoromethanesulfonate is sourced from PubChem (CID 10967281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).