C13H30O3Si — CID 10967320
(2S,3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentane-1,3-diol (PubChem CID 10967320) has the molecular formula C13H30O3Si and a molecular weight of 262.47 g/mol. Its IUPAC name is (2S,3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentane-1,3-diol.
| Compound Name | (2S,3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 10967320 |
| Molecular Formula | C13H30O3Si |
| Molecular Weight | 262.47 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (2S,3R,4S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylpentane-1,3-diol |
| SMILES | C[C@@H](CO)[C@@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30O3Si/c1-10(8-14)12(15)11(2)9-16-17(6,7)13(3,4)5/h10-12,14-15H,8-9H2,1-7H3/t10-,11-,12+/m0/s1 |
| InChIKey | KNZWSZJHRGVXJC-SDDRHHMPSA-N |
| XLogP | 2.63 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|