About 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde
6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde (PubChem CID 10967372) has the molecular formula C14H16O5
and a molecular weight of 264.28 g/mol. Its IUPAC name is 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde.
Molecular Properties
| Compound Name | 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde |
| PubChem CID | 10967372 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde |
| SMILES | O=Cc1c(OC2CCCCO2)ccc2c1OCCO2 |
| InChI | InChI=1S/C14H16O5/c15-9-10-11(19-13-3-1-2-6-17-13)4-5-12-14(10)18-8-7-16-12/h4-5,9,13H,1-3,6-8H2 |
| InChIKey | HBAQXDXMVCERGP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde?
The IUPAC name of 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde (CID 10967372) is 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde.
What is the SMILES notation for 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde?
The canonical SMILES for 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde is O=Cc1c(OC2CCCCO2)ccc2c1OCCO2.
What is the InChIKey of 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde?
The InChIKey is HBAQXDXMVCERGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O5/c15-9-10-11(19-13-3-1-2-6-17-13)4-5-12-14(10)18-8-7-16-12/h4-5,9,13H,1-3,6-8H2.
What are the key properties of 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde?
6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde has a molecular weight of 264.28 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(oxan-2-yloxy)-2,3-dihydro-1,4-benzodioxine-5-carbaldehyde is sourced from PubChem (CID 10967372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).