C9H14O7S — CID 10967435
[(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate (PubChem CID 10967435) has the molecular formula C9H14O7S and a molecular weight of 266.27 g/mol. Its IUPAC name is [(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate.
| Compound Name | [(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10967435 |
| Molecular Formula | C9H14O7S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [(3aS,6R,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-6-yl]methyl methanesulfonate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)C(=O)O[C@@H]2COS(C)(=O)=O |
| InChI | InChI=1S/C9H14O7S/c1-9(2)15-6-5(4-13-17(3,11)12)14-8(10)7(6)16-9/h5-7H,4H2,1-3H3/t5-,6+,7+/m1/s1 |
| InChIKey | DHDJYKFZAGNFLU-VQVTYTSYSA-N |
| XLogP | -0.59 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|