C13H20O6 — CID 10967636
ethyl (3aR,6S,6aS)-6-butyl-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carboxylate (PubChem CID 10967636) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is ethyl (3aR,6S,6aS)-6-butyl-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carboxylate.
| Compound Name | ethyl (3aR,6S,6aS)-6-butyl-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carboxylate |
|---|---|
| PubChem CID | 10967636 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | ethyl (3aR,6S,6aS)-6-butyl-4-hydroxy-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-3-carboxylate |
| SMILES | CCCC[C@@H]1OC(O)[C@@H]2C(C(=O)OCC)C(=O)O[C@@H]21 |
| InChI | InChI=1S/C13H20O6/c1-3-5-6-7-10-8(12(15)18-7)9(13(16)19-10)11(14)17-4-2/h7-10,12,15H,3-6H2,1-2H3/t7-,8+,9?,10+,12?/m0/s1 |
| InChIKey | HIJFYNQUIVWWBI-SSGOAMSISA-N |
| XLogP | 0.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|