C18H28O2 — CID 10967785
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10967785) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10967785 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (1R,2R,4R)-bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)[C@@H]1C[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H28O2/c1-11(2)15-7-4-12(3)8-17(15)20-18(19)16-10-13-5-6-14(16)9-13/h5-6,11-17H,4,7-10H2,1-3H3/t12-,13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | NUXWNOJUDXSANL-KOWPAETKSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|