C18H30O2 — CID 10967863
(1S,3aS,5R,7aR)-5-(cyclohexylmethyl)-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde (PubChem CID 10967863) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (1S,3aS,5R,7aR)-5-(cyclohexylmethyl)-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde.
| Compound Name | (1S,3aS,5R,7aR)-5-(cyclohexylmethyl)-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 10967863 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (1S,3aS,5R,7aR)-5-(cyclohexylmethyl)-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydro-1H-indene-1-carbaldehyde |
| SMILES | C[C@]12CC[C@H](CC3CCCCC3)C[C@@]1(O)CC[C@@H]2C=O |
| InChI | InChI=1S/C18H30O2/c1-17-9-7-15(11-14-5-3-2-4-6-14)12-18(17,20)10-8-16(17)13-19/h13-16,20H,2-12H2,1H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | YPAOPTUYOGLBPU-TVFCKZIOSA-N |
| XLogP | 4.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|