C7F8N2O — CID 10967895
N,2,2,2-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide (PubChem CID 10967895) has the molecular formula C7F8N2O and a molecular weight of 280.07 g/mol. Its IUPAC name is N,2,2,2-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide.
| Compound Name | N,2,2,2-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
|---|---|
| PubChem CID | 10967895 |
| Molecular Formula | C7F8N2O |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | N,2,2,2-tetrafluoro-N-(2,3,5,6-tetrafluoro-4-pyridinyl)acetamide |
| SMILES | O=C(N(F)c1c(F)c(F)nc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C7F8N2O/c8-1-3(2(9)5(11)16-4(1)10)17(15)6(18)7(12,13)14 |
| InChIKey | HZSMAKAYENTVSS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|