C16H24O4 — CID 10967912
(1R,5S,7R,11R)-9-methoxy-11-(methoxymethoxy)-5,7-dimethyltricyclo[5.3.1.01,5]undec-8-en-10-one (PubChem CID 10967912) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (1R,5S,7R,11R)-9-methoxy-11-(methoxymethoxy)-5,7-dimethyltricyclo[5.3.1.01,5]undec-8-en-10-one.
| Compound Name | (1R,5S,7R,11R)-9-methoxy-11-(methoxymethoxy)-5,7-dimethyltricyclo[5.3.1.01,5]undec-8-en-10-one |
|---|---|
| PubChem CID | 10967912 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (1R,5S,7R,11R)-9-methoxy-11-(methoxymethoxy)-5,7-dimethyltricyclo[5.3.1.01,5]undec-8-en-10-one |
| SMILES | COCO[C@@H]1[C@@]2(C)C=C(OC)C(=O)[C@@]13CCC[C@@]3(C)C2 |
| InChI | InChI=1S/C16H24O4/c1-14-8-11(19-4)12(17)16(13(14)20-10-18-3)7-5-6-15(16,2)9-14/h8,13H,5-7,9-10H2,1-4H3/t13-,14+,15+,16+/m1/s1 |
| InChIKey | WZTZMZKBCCUQAI-UGUYLWEFSA-N |
| XLogP | 2.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|