C14H24O4Si — CID 10968055
(1R,4S,5S)-4-methyl-1-[(E)-2-methyl-1-trimethylsilyloxypent-2-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one (PubChem CID 10968055) has the molecular formula C14H24O4Si and a molecular weight of 284.43 g/mol. Its IUPAC name is (1R,4S,5S)-4-methyl-1-[(E)-2-methyl-1-trimethylsilyloxypent-2-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5S)-4-methyl-1-[(E)-2-methyl-1-trimethylsilyloxypent-2-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 10968055 |
| Molecular Formula | C14H24O4Si |
| Molecular Weight | 284.43 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (1R,4S,5S)-4-methyl-1-[(E)-2-methyl-1-trimethylsilyloxypent-2-enyl]-3,6-dioxabicyclo[3.1.0]hexan-2-one |
| SMILES | CC/C=C(\C)C(O[Si](C)(C)C)[C@]12O[C@H]1[C@H](C)OC2=O |
| InChI | InChI=1S/C14H24O4Si/c1-7-8-9(2)11(18-19(4,5)6)14-12(17-14)10(3)16-13(14)15/h8,10-12H,7H2,1-6H3/b9-8+/t10-,11?,12-,14-/m0/s1 |
| InChIKey | IXHTVYODLJQBPN-WYWLQHDISA-N |
| XLogP | 2.65 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|