C19H19N3O2S — CID 1096806
N-benzyl-2-(4-methoxyanilino)-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 1096806) has the molecular formula C19H19N3O2S and a molecular weight of 353.45 g/mol. Its IUPAC name is N-benzyl-2-(4-methoxyanilino)-N-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-benzyl-2-(4-methoxyanilino)-N-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 1096806 |
| Molecular Formula | C19H19N3O2S |
| Molecular Weight | 353.45 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-benzyl-2-(4-methoxyanilino)-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | COc1ccc(Nc2nc(C(=O)N(C)Cc3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C19H19N3O2S/c1-22(12-14-6-4-3-5-7-14)18(23)17-13-25-19(21-17)20-15-8-10-16(24-2)11-9-15/h3-11,13H,12H2,1-2H3,(H,20,21) |
| InChIKey | LAKAILIBGZXITQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.45 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |