C13H14Cl2N2O — CID 10968067
(10R,11R,11aS)-2,10-dichloro-11-methyl-5,8,9,10,11,11a-hexahydropyrido[1,2-c]quinazolin-6-one (PubChem CID 10968067) has the molecular formula C13H14Cl2N2O and a molecular weight of 285.17 g/mol. Its IUPAC name is (10R,11R,11aS)-2,10-dichloro-11-methyl-5,8,9,10,11,11a-hexahydropyrido[1,2-c]quinazolin-6-one.
| Compound Name | (10R,11R,11aS)-2,10-dichloro-11-methyl-5,8,9,10,11,11a-hexahydropyrido[1,2-c]quinazolin-6-one |
|---|---|
| PubChem CID | 10968067 |
| Molecular Formula | C13H14Cl2N2O |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | (10R,11R,11aS)-2,10-dichloro-11-methyl-5,8,9,10,11,11a-hexahydropyrido[1,2-c]quinazolin-6-one |
| SMILES | C[C@H]1[C@H](Cl)CCN2C(=O)Nc3ccc(Cl)cc3[C@H]12 |
| InChI | InChI=1S/C13H14Cl2N2O/c1-7-10(15)4-5-17-12(7)9-6-8(14)2-3-11(9)16-13(17)18/h2-3,6-7,10,12H,4-5H2,1H3,(H,16,18)/t7-,10+,12-/m0/s1 |
| InChIKey | XACIEKHSDLLSIH-KOLSJAJHSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|