About 1-dodecylindole
1-dodecylindole (PubChem CID 10968089) has the molecular formula C20H31N
and a molecular weight of 285.47 g/mol. Its IUPAC name is 1-dodecylindole.
Molecular Properties
| Compound Name | 1-dodecylindole |
| PubChem CID | 10968089 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-dodecylindole |
| SMILES | CCCCCCCCCCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C20H31N/c1-2-3-4-5-6-7-8-9-10-13-17-21-18-16-19-14-11-12-15-20(19)21/h11-12,14-16,18H,2-10,13,17H2,1H3 |
| InChIKey | SHOVGCMSECPWIN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecylindole?
The IUPAC name of 1-dodecylindole (CID 10968089) is 1-dodecylindole.
What is the SMILES notation for 1-dodecylindole?
The canonical SMILES for 1-dodecylindole is CCCCCCCCCCCCn1ccc2ccccc21.
What is the InChIKey of 1-dodecylindole?
The InChIKey is SHOVGCMSECPWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31N/c1-2-3-4-5-6-7-8-9-10-13-17-21-18-16-19-14-11-12-15-20(19)21/h11-12,14-16,18H,2-10,13,17H2,1H3.
What are the key properties of 1-dodecylindole?
1-dodecylindole has a molecular weight of 285.47 g/mol, XLogP of 6.56, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecylindole is sourced from PubChem (CID 10968089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).