About 3-(4-acetylphenyl)-1,1-dibutylurea
3-(4-acetylphenyl)-1,1-dibutylurea (PubChem CID 10968248) has the molecular formula C17H26N2O2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(4-acetylphenyl)-1,1-dibutylurea.
Molecular Properties
| Compound Name | 3-(4-acetylphenyl)-1,1-dibutylurea |
| PubChem CID | 10968248 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 3-(4-acetylphenyl)-1,1-dibutylurea |
| SMILES | CCCCN(CCCC)C(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C17H26N2O2/c1-4-6-12-19(13-7-5-2)17(21)18-16-10-8-15(9-11-16)14(3)20/h8-11H,4-7,12-13H2,1-3H3,(H,18,21) |
| InChIKey | RHZRGNBQZOEJJF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-acetylphenyl)-1,1-dibutylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-acetylphenyl)-1,1-dibutylurea?
The IUPAC name of 3-(4-acetylphenyl)-1,1-dibutylurea (CID 10968248) is 3-(4-acetylphenyl)-1,1-dibutylurea.
What is the SMILES notation for 3-(4-acetylphenyl)-1,1-dibutylurea?
The canonical SMILES for 3-(4-acetylphenyl)-1,1-dibutylurea is CCCCN(CCCC)C(=O)Nc1ccc(C(C)=O)cc1.
What is the InChIKey of 3-(4-acetylphenyl)-1,1-dibutylurea?
The InChIKey is RHZRGNBQZOEJJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2/c1-4-6-12-19(13-7-5-2)17(21)18-16-10-8-15(9-11-16)14(3)20/h8-11H,4-7,12-13H2,1-3H3,(H,18,21).
What are the key properties of 3-(4-acetylphenyl)-1,1-dibutylurea?
3-(4-acetylphenyl)-1,1-dibutylurea has a molecular weight of 290.41 g/mol, XLogP of 4.32, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-acetylphenyl)-1,1-dibutylurea is sourced from PubChem (CID 10968248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).