C19H30O2 — CID 10968253
(1S,4aR,5'R,8aR)-5'-ethenyl-5,5,5',8a-tetramethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-1,2'-oxolane]-2-one (PubChem CID 10968253) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (1S,4aR,5'R,8aR)-5'-ethenyl-5,5,5',8a-tetramethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-1,2'-oxolane]-2-one.
| Compound Name | (1S,4aR,5'R,8aR)-5'-ethenyl-5,5,5',8a-tetramethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-1,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 10968253 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1S,4aR,5'R,8aR)-5'-ethenyl-5,5,5',8a-tetramethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-1,2'-oxolane]-2-one |
| SMILES | C=C[C@@]1(C)CC[C@@]2(O1)C(=O)CC[C@@H]1C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C19H30O2/c1-6-17(4)12-13-19(21-17)15(20)9-8-14-16(2,3)10-7-11-18(14,19)5/h6,14H,1,7-13H2,2-5H3/t14-,17+,18-,19-/m1/s1 |
| InChIKey | OAZAVWMYVRHZFU-ZWQIFLOQSA-N |
| XLogP | 4.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|