C15H17NO5 — CID 10968266
(4aR,4bR,8aS,9R)-8a-methoxy-9-nitro-4b,5,6,7,8,9-hexahydro-4aH-phenanthrene-1,4-dione (PubChem CID 10968266) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is (4aR,4bR,8aS,9R)-8a-methoxy-9-nitro-4b,5,6,7,8,9-hexahydro-4aH-phenanthrene-1,4-dione.
| Compound Name | (4aR,4bR,8aS,9R)-8a-methoxy-9-nitro-4b,5,6,7,8,9-hexahydro-4aH-phenanthrene-1,4-dione |
|---|---|
| PubChem CID | 10968266 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | (4aR,4bR,8aS,9R)-8a-methoxy-9-nitro-4b,5,6,7,8,9-hexahydro-4aH-phenanthrene-1,4-dione |
| SMILES | CO[C@@]12CCCC[C@@H]1[C@H]1C(=O)C=CC(=O)C1=C[C@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C15H17NO5/c1-21-15-7-3-2-4-10(15)14-9(8-13(15)16(19)20)11(17)5-6-12(14)18/h5-6,8,10,13-14H,2-4,7H2,1H3/t10-,13-,14+,15+/m1/s1 |
| InChIKey | CDINBADMBKSFFB-RABLLNBGSA-N |
| XLogP | 1.47 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|