C13H16N4S2 — CID 10968327
7,7,7a-trimethyl-3-phenyl-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dithione (PubChem CID 10968327) has the molecular formula C13H16N4S2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 7,7,7a-trimethyl-3-phenyl-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dithione.
| Compound Name | 7,7,7a-trimethyl-3-phenyl-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dithione |
|---|---|
| PubChem CID | 10968327 |
| Molecular Formula | C13H16N4S2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 7,7,7a-trimethyl-3-phenyl-1,6-dihydroimidazo[1,5-b][1,2,4]triazole-2,5-dithione |
| SMILES | CC1(C)NC(=S)N2N(c3ccccc3)C(=S)NC21C |
| InChI | InChI=1S/C13H16N4S2/c1-12(2)13(3)15-10(18)16(17(13)11(19)14-12)9-7-5-4-6-8-9/h4-8H,1-3H3,(H,14,19)(H,15,18) |
| InChIKey | YGDWZNVNJPCLCD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|