C12H11F5N2O — CID 10968384
3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-4H-imidazol-5-ol (PubChem CID 10968384) has the molecular formula C12H11F5N2O and a molecular weight of 294.22 g/mol. Its IUPAC name is 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-4H-imidazol-5-ol.
| Compound Name | 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-4H-imidazol-5-ol |
|---|---|
| PubChem CID | 10968384 |
| Molecular Formula | C12H11F5N2O |
| Molecular Weight | 294.22 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-methyl-5-(1,1,2,2,2-pentafluoroethyl)-2-phenyl-4H-imidazol-5-ol |
| SMILES | CN1CC(O)(C(F)(F)C(F)(F)F)N=C1c1ccccc1 |
| InChI | InChI=1S/C12H11F5N2O/c1-19-7-10(20,11(13,14)12(15,16)17)18-9(19)8-5-3-2-4-6-8/h2-6,20H,7H2,1H3 |
| InChIKey | ZODJPBPCLVFFLQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|