About (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one
(E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one (PubChem CID 10968413) has the molecular formula C16H22O3S
and a molecular weight of 294.42 g/mol. Its IUPAC name is (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one.
Molecular Properties
| Compound Name | (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one |
| PubChem CID | 10968413 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one |
| SMILES | CC(C)CC(=O)C[C@@H](C)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-13(2)11-15(17)12-14(3)9-10-20(18,19)16-7-5-4-6-8-16/h4-10,13-14H,11-12H2,1-3H3/b10-9+/t14-/m0/s1 |
| InChIKey | NLSJVHIHDRQKQE-HBWSCVEGSA-N |
| XLogP | 3.62 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one?
The IUPAC name of (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one (CID 10968413) is (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one.
What is the SMILES notation for (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one?
The canonical SMILES for (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one is CC(C)CC(=O)C[C@@H](C)/C=C/S(=O)(=O)c1ccccc1.
What is the InChIKey of (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one?
The InChIKey is NLSJVHIHDRQKQE-HBWSCVEGSA-N. The full InChI is InChI=1S/C16H22O3S/c1-13(2)11-15(17)12-14(3)9-10-20(18,19)16-7-5-4-6-8-16/h4-10,13-14H,11-12H2,1-3H3/b10-9+/t14-/m0/s1.
What are the key properties of (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one?
(E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one has a molecular weight of 294.42 g/mol, XLogP of 3.62, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,6R)-8-(benzenesulfonyl)-2,6-dimethyloct-7-en-4-one is sourced from PubChem (CID 10968413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).