C22H34 — CID 10968547
(9R,10R)-9,10-bis(ethenyl)octadeca-5,13-diyne (PubChem CID 10968547) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (9R,10R)-9,10-bis(ethenyl)octadeca-5,13-diyne.
| Compound Name | (9R,10R)-9,10-bis(ethenyl)octadeca-5,13-diyne |
|---|---|
| PubChem CID | 10968547 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (9R,10R)-9,10-bis(ethenyl)octadeca-5,13-diyne |
| SMILES | C=C[C@@H](CCC#CCCCC)[C@@H](C=C)CCC#CCCCC |
| InChI | InChI=1S/C22H34/c1-5-9-11-13-15-17-19-21(7-3)22(8-4)20-18-16-14-12-10-6-2/h7-8,21-22H,3-6,9-12,17-20H2,1-2H3/t21-,22-/m0/s1 |
| InChIKey | AIYNOLBOFBFODH-VXKWHMMOSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|