About [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate (PubChem CID 10968681) has the molecular formula C14H13N3O3S
and a molecular weight of 303.34 g/mol. Its IUPAC name is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate.
Molecular Properties
| Compound Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate |
| PubChem CID | 10968681 |
| Molecular Formula | C14H13N3O3S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)Oc1cccnc1C(=O)Nc1nccs1 |
| InChI | InChI=1S/C14H13N3O3S/c1-9(2)8-11(18)20-10-4-3-5-15-12(10)13(19)17-14-16-6-7-21-14/h3-8H,1-2H3,(H,16,17,19) |
| InChIKey | HXMWBPFAEQPIPD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate?
The IUPAC name of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate (CID 10968681) is [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate.
What is the SMILES notation for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate?
The canonical SMILES for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate is CC(C)=CC(=O)Oc1cccnc1C(=O)Nc1nccs1.
What is the InChIKey of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate?
The InChIKey is HXMWBPFAEQPIPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O3S/c1-9(2)8-11(18)20-10-4-3-5-15-12(10)13(19)17-14-16-6-7-21-14/h3-8H,1-2H3,(H,16,17,19).
What are the key properties of [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate?
[2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate has a molecular weight of 303.34 g/mol, XLogP of 2.66, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,3-thiazol-2-ylcarbamoyl)-3-pyridinyl] 3-methylbut-2-enoate is sourced from PubChem (CID 10968681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).