C19H19NO3 — CID 10968880
(1S,9R,11S)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one (PubChem CID 10968880) has the molecular formula C19H19NO3 and a molecular weight of 309.36 g/mol. Its IUPAC name is (1S,9R,11S)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one.
| Compound Name | (1S,9R,11S)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one |
|---|---|
| PubChem CID | 10968880 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (1S,9R,11S)-1,11,12-trimethyl-6-phenyl-8,10-dioxa-4-azatricyclo[7.4.0.02,7]trideca-2(7),5,12-trien-3-one |
| SMILES | CC1=C[C@@]2(C)c3c(c(-c4ccccc4)c[nH]c3=O)O[C@H]2O[C@H]1C |
| InChI | InChI=1S/C19H19NO3/c1-11-9-19(3)15-16(23-18(19)22-12(11)2)14(10-20-17(15)21)13-7-5-4-6-8-13/h4-10,12,18H,1-3H3,(H,20,21)/t12-,18+,19-/m0/s1 |
| InChIKey | PXSYKUIWENRRCE-RQUSPXKASA-N |
| XLogP | 3.38 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|