C16H26O6 — CID 10969048
ethyl (E)-3-[(2R,3aS,5S,7R,7aS)-2,5-diethoxy-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-7-yl]prop-2-enoate (PubChem CID 10969048) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3aS,5S,7R,7aS)-2,5-diethoxy-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-7-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3aS,5S,7R,7aS)-2,5-diethoxy-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10969048 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | ethyl (E)-3-[(2R,3aS,5S,7R,7aS)-2,5-diethoxy-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyran-7-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1O[C@H](OCC)C[C@@H]2C[C@H](OCC)O[C@@H]21 |
| InChI | InChI=1S/C16H26O6/c1-4-18-13(17)8-7-12-16-11(9-14(21-12)19-5-2)10-15(22-16)20-6-3/h7-8,11-12,14-16H,4-6,9-10H2,1-3H3/b8-7+/t11-,12-,14+,15-,16+/m1/s1 |
| InChIKey | INQRLMWPNIUBKC-HGVPPELXSA-N |
| XLogP | 2.02 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|