C19H28O4 — CID 10969263
dimethyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate (PubChem CID 10969263) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is dimethyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10969263 |
| Molecular Formula | C19H28O4 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | dimethyl (3aS,4Z,8aS)-4-(2,2-dimethylpropylidene)-1,3,3a,5,6,8a-hexahydroazulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2C=CCC/C(=C/C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C19H28O4/c1-18(2,3)10-13-8-6-7-9-14-11-19(12-15(13)14,16(20)22-4)17(21)23-5/h7,9-10,14-15H,6,8,11-12H2,1-5H3/b13-10-/t14-,15-/m1/s1 |
| InChIKey | NJVYCZONGLXPHN-TZNPFNDMSA-N |
| XLogP | 3.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|