About 1,5-dibromo-2,4-dichloro-3-fluorobenzene
1,5-dibromo-2,4-dichloro-3-fluorobenzene (PubChem CID 10969348) has the molecular formula C6HBr2Cl2F
and a molecular weight of 322.79 g/mol. Its IUPAC name is 1,5-dibromo-2,4-dichloro-3-fluorobenzene.
Molecular Properties
| Compound Name | 1,5-dibromo-2,4-dichloro-3-fluorobenzene |
| PubChem CID | 10969348 |
| Molecular Formula | C6HBr2Cl2F |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 319.78 |
| IUPAC Name | 1,5-dibromo-2,4-dichloro-3-fluorobenzene |
| SMILES | Fc1c(Cl)c(Br)cc(Br)c1Cl |
| InChI | InChI=1S/C6HBr2Cl2F/c7-2-1-3(8)5(10)6(11)4(2)9/h1H |
| InChIKey | ABEJMXZVDXFLCD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1,5-dibromo-2,4-dichloro-3-fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromo-2,4-dichloro-3-fluorobenzene?
The IUPAC name of 1,5-dibromo-2,4-dichloro-3-fluorobenzene (CID 10969348) is 1,5-dibromo-2,4-dichloro-3-fluorobenzene.
What is the SMILES notation for 1,5-dibromo-2,4-dichloro-3-fluorobenzene?
The canonical SMILES for 1,5-dibromo-2,4-dichloro-3-fluorobenzene is Fc1c(Cl)c(Br)cc(Br)c1Cl.
What is the InChIKey of 1,5-dibromo-2,4-dichloro-3-fluorobenzene?
The InChIKey is ABEJMXZVDXFLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6HBr2Cl2F/c7-2-1-3(8)5(10)6(11)4(2)9/h1H.
What are the key properties of 1,5-dibromo-2,4-dichloro-3-fluorobenzene?
1,5-dibromo-2,4-dichloro-3-fluorobenzene has a molecular weight of 322.79 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromo-2,4-dichloro-3-fluorobenzene is sourced from PubChem (CID 10969348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).