C18H33NO2Si — CID 10969374
(3S)-4-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-3-methylbutanenitrile (PubChem CID 10969374) has the molecular formula C18H33NO2Si and a molecular weight of 323.55 g/mol. Its IUPAC name is (3S)-4-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-3-methylbutanenitrile.
| Compound Name | (3S)-4-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-3-methylbutanenitrile |
|---|---|
| PubChem CID | 10969374 |
| Molecular Formula | C18H33NO2Si |
| Molecular Weight | 323.55 g/mol |
| Exact Mass | 323.23 |
| IUPAC Name | (3S)-4-[(2R,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3,6-dihydro-2H-pyran-2-yl]-3-methylbutanenitrile |
| SMILES | C[C@@H](CC#N)C[C@@H]1CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H33NO2Si/c1-15(10-12-19)14-17-9-7-8-16(21-17)11-13-20-22(5,6)18(2,3)4/h7-8,15-17H,9-11,13-14H2,1-6H3/t15-,16-,17-/m0/s1 |
| InChIKey | GHWDZDASYGNMML-ULQDDVLXSA-N |
| XLogP | 5.05 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|