C18H19N3O3 — CID 10969404
(3aR,7aS)-3-(4-oxo-2-propan-2-ylquinazolin-3-yl)-3a,4,5,7a-tetrahydro-1,3-benzoxazol-2-one (PubChem CID 10969404) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (3aR,7aS)-3-(4-oxo-2-propan-2-ylquinazolin-3-yl)-3a,4,5,7a-tetrahydro-1,3-benzoxazol-2-one.
| Compound Name | (3aR,7aS)-3-(4-oxo-2-propan-2-ylquinazolin-3-yl)-3a,4,5,7a-tetrahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 10969404 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (3aR,7aS)-3-(4-oxo-2-propan-2-ylquinazolin-3-yl)-3a,4,5,7a-tetrahydro-1,3-benzoxazol-2-one |
| SMILES | CC(C)c1nc2ccccc2c(=O)n1N1C(=O)O[C@H]2C=CCC[C@H]21 |
| InChI | InChI=1S/C18H19N3O3/c1-11(2)16-19-13-8-4-3-7-12(13)17(22)21(16)20-14-9-5-6-10-15(14)24-18(20)23/h3-4,6-8,10-11,14-15H,5,9H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | QQXZDLXIAKLGPQ-CABCVRRESA-N |
| XLogP | 2.70 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|