About (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate
(4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate (PubChem CID 10969445) has the molecular formula C19H22N2O3
and a molecular weight of 326.40 g/mol. Its IUPAC name is (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate |
| PubChem CID | 10969445 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate |
| SMILES | CC(C)c1c(C(=O)OC2CCC(=O)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-13(2)18-17(12-20-21(18)14-6-4-3-5-7-14)19(23)24-16-10-8-15(22)9-11-16/h3-7,12-13,16H,8-11H2,1-2H3 |
| InChIKey | LMMAXQMHDJZLCR-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate?
The IUPAC name of (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate (CID 10969445) is (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate.
What is the SMILES notation for (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate?
The canonical SMILES for (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate is CC(C)c1c(C(=O)OC2CCC(=O)CC2)cnn1-c1ccccc1.
What is the InChIKey of (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate?
The InChIKey is LMMAXQMHDJZLCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O3/c1-13(2)18-17(12-20-21(18)14-6-4-3-5-7-14)19(23)24-16-10-8-15(22)9-11-16/h3-7,12-13,16H,8-11H2,1-2H3.
What are the key properties of (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate?
(4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate has a molecular weight of 326.40 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxocyclohexyl) 1-phenyl-5-propan-2-ylpyrazole-4-carboxylate is sourced from PubChem (CID 10969445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).