C14H21N3O6 — CID 10969480
methyl (2S,3S,4aR,5R,8aR)-5-azido-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxine-7-carboxylate (PubChem CID 10969480) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is methyl (2S,3S,4aR,5R,8aR)-5-azido-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | methyl (2S,3S,4aR,5R,8aR)-5-azido-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 10969480 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | methyl (2S,3S,4aR,5R,8aR)-5-azido-2,3-dimethoxy-2,3-dimethyl-4a,5,8,8a-tetrahydro-1,4-benzodioxine-7-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](N=[N+]=[N-])[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]2C1 |
| InChI | InChI=1S/C14H21N3O6/c1-13(20-4)14(2,21-5)23-11-9(16-17-15)6-8(12(18)19-3)7-10(11)22-13/h6,9-11H,7H2,1-5H3/t9-,10-,11-,13+,14+/m1/s1 |
| InChIKey | LBYFMMGIJADGOJ-AFCCXKIYSA-N |
| XLogP | 1.68 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|