C20H18O3S — CID 10969810
(1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethanol (PubChem CID 10969810) has the molecular formula C20H18O3S and a molecular weight of 338.43 g/mol. Its IUPAC name is (1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethanol.
| Compound Name | (1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethanol |
|---|---|
| PubChem CID | 10969810 |
| Molecular Formula | C20H18O3S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (1R,2S)-2-(benzenesulfonyl)-1,2-diphenylethanol |
| SMILES | O=S(=O)(c1ccccc1)[C@@H](c1ccccc1)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C20H18O3S/c21-19(16-10-4-1-5-11-16)20(17-12-6-2-7-13-17)24(22,23)18-14-8-3-9-15-18/h1-15,19-21H/t19-,20+/m1/s1 |
| InChIKey | XLDOSVYVAXYNFW-UXHICEINSA-N |
| XLogP | 3.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |