C16H24O8 — CID 10969977
(E)-5-hydroxy-5-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]pent-2-enoic acid (PubChem CID 10969977) has the molecular formula C16H24O8 and a molecular weight of 344.36 g/mol. Its IUPAC name is (E)-5-hydroxy-5-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]pent-2-enoic acid.
| Compound Name | (E)-5-hydroxy-5-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]pent-2-enoic acid |
|---|---|
| PubChem CID | 10969977 |
| Molecular Formula | C16H24O8 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (E)-5-hydroxy-5-[(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-6-yl]pent-2-enoic acid |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@@]3(C(O)C/C=C/C(=O)O)OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C16H24O8/c1-14(2)21-9-8-20-16(10(17)6-5-7-11(18)19)13(12(9)22-14)23-15(3,4)24-16/h5,7,9-10,12-13,17H,6,8H2,1-4H3,(H,18,19)/b7-5+/t9-,10?,12-,13+,16+/m1/s1 |
| InChIKey | MSGMRZBGAAVSCD-IHYHWJQRSA-N |
| XLogP | 0.78 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|