About 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate
1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate (PubChem CID 10970149) has the molecular formula C16H16ClN3O4
and a molecular weight of 349.77 g/mol. Its IUPAC name is 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate.
Molecular Properties
| Compound Name | 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate |
| PubChem CID | 10970149 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 349.77 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate |
| SMILES | Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ncc[nH]1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C16H16N3.ClHO4/c1-12-10-15(14-6-4-3-5-7-14)11-13(2)19(12)16-17-8-9-18-16;2-1(3,4)5/h3-11H,1-2H3,(H,17,18);(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | GEKFQXOJVNEOBI-UHFFFAOYSA-M |
| XLogP | -1.79 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.77 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate?
The IUPAC name of 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate (CID 10970149) is 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate.
What is the SMILES notation for 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate?
The canonical SMILES for 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate is Cc1cc(-c2ccccc2)cc(C)[n+]1-c1ncc[nH]1.[O-][Cl+3]([O-])([O-])[O-].
What is the InChIKey of 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate?
The InChIKey is GEKFQXOJVNEOBI-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H16N3.ClHO4/c1-12-10-15(14-6-4-3-5-7-14)11-13(2)19(12)16-17-8-9-18-16;2-1(3,4)5/h3-11H,1-2H3,(H,17,18);(H,2,3,4,5)/q+1;/p-1.
What are the key properties of 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate?
1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate has a molecular weight of 349.77 g/mol, XLogP of -1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-imidazol-2-yl)-2,6-dimethyl-4-phenylpyridin-1-ium perchlorate is sourced from PubChem (CID 10970149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).