C19H35N2O2P — CID 10970281
N-[dimethylamino-[(1R,4R,5R,10R)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-7-en-10-yl]oxyphosphoryl]-N-methylmethanamine (PubChem CID 10970281) has the molecular formula C19H35N2O2P and a molecular weight of 354.48 g/mol. Its IUPAC name is N-[dimethylamino-[(1R,4R,5R,10R)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-7-en-10-yl]oxyphosphoryl]-N-methylmethanamine.
| Compound Name | N-[dimethylamino-[(1R,4R,5R,10R)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-7-en-10-yl]oxyphosphoryl]-N-methylmethanamine |
|---|---|
| PubChem CID | 10970281 |
| Molecular Formula | C19H35N2O2P |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | N-[dimethylamino-[(1R,4R,5R,10R)-1,8-dimethyl-4-prop-1-en-2-ylspiro[4.5]dec-7-en-10-yl]oxyphosphoryl]-N-methylmethanamine |
| SMILES | C=C(C)[C@H]1CC[C@@H](C)[C@]12CC=C(C)C[C@H]2OP(=O)(N(C)C)N(C)C |
| InChI | InChI=1S/C19H35N2O2P/c1-14(2)17-10-9-16(4)19(17)12-11-15(3)13-18(19)23-24(22,20(5)6)21(7)8/h11,16-18H,1,9-10,12-13H2,2-8H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | KPFODVANEADJBC-NCXUSEDFSA-N |
| XLogP | 4.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|