About 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine
1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine (PubChem CID 10970331) has the molecular formula C18H20N4O2S
and a molecular weight of 356.45 g/mol. Its IUPAC name is 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine.
Molecular Properties
| Compound Name | 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| PubChem CID | 10970331 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| SMILES | NC1=NC2(CCN(S(=O)(=O)c3ccccc3)CC2)Nc2ccccc21 |
| InChI | InChI=1S/C18H20N4O2S/c19-17-15-8-4-5-9-16(15)20-18(21-17)10-12-22(13-11-18)25(23,24)14-6-2-1-3-7-14/h1-9,20H,10-13H2,(H2,19,21) |
| InChIKey | WSPPFKUACOZVMQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The IUPAC name of 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine (CID 10970331) is 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine.
What is the SMILES notation for 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The canonical SMILES for 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine is NC1=NC2(CCN(S(=O)(=O)c3ccccc3)CC2)Nc2ccccc21.
What is the InChIKey of 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
The InChIKey is WSPPFKUACOZVMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2S/c19-17-15-8-4-5-9-16(15)20-18(21-17)10-12-22(13-11-18)25(23,24)14-6-2-1-3-7-14/h1-9,20H,10-13H2,(H2,19,21).
What are the key properties of 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine?
1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine has a molecular weight of 356.45 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine is sourced from PubChem (CID 10970331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).