C18H20N4O2S — CID 10970331
1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine (PubChem CID 10970331) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine.
| Compound Name | 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
|---|---|
| PubChem CID | 10970331 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1'-(benzenesulfonyl)spiro[1H-quinazoline-2,4'-piperidine]-4-amine |
| SMILES | NC1=NC2(CCN(S(=O)(=O)c3ccccc3)CC2)Nc2ccccc21 |
| InChI | InChI=1S/C18H20N4O2S/c19-17-15-8-4-5-9-16(15)20-18(21-17)10-12-22(13-11-18)25(23,24)14-6-2-1-3-7-14/h1-9,20H,10-13H2,(H2,19,21) |
| InChIKey | WSPPFKUACOZVMQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |