C23H26O2S — CID 10970578
(1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-propan-2-yl-8-oxabicyclo[5.1.0]octane (PubChem CID 10970578) has the molecular formula C23H26O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-propan-2-yl-8-oxabicyclo[5.1.0]octane.
| Compound Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-propan-2-yl-8-oxabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 10970578 |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (1S,2E,4R,7R)-4-(benzenesulfinyl)-2-benzylidene-1-propan-2-yl-8-oxabicyclo[5.1.0]octane |
| SMILES | CC(C)[C@@]12O[C@@H]1CC[C@@H](S(=O)c1ccccc1)C/C2=C\c1ccccc1 |
| InChI | InChI=1S/C23H26O2S/c1-17(2)23-19(15-18-9-5-3-6-10-18)16-21(13-14-22(23)25-23)26(24)20-11-7-4-8-12-20/h3-12,15,17,21-22H,13-14,16H2,1-2H3/b19-15+/t21-,22-,23+,26?/m1/s1 |
| InChIKey | RVGOEHLTWGYVSX-UTCAISFESA-N |
| XLogP | 5.22 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|