C22H29NO4 — CID 10970720
(4'aS,8'aR)-2'-(cyclopropylmethyl)-4'a-(3-methoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,5,7,8,8a-hexahydroisoquinoline]-1'-one (PubChem CID 10970720) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (4'aS,8'aR)-2'-(cyclopropylmethyl)-4'a-(3-methoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,5,7,8,8a-hexahydroisoquinoline]-1'-one.
| Compound Name | (4'aS,8'aR)-2'-(cyclopropylmethyl)-4'a-(3-methoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,5,7,8,8a-hexahydroisoquinoline]-1'-one |
|---|---|
| PubChem CID | 10970720 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (4'aS,8'aR)-2'-(cyclopropylmethyl)-4'a-(3-methoxyphenyl)spiro[1,3-dioxolane-2,6'-3,4,5,7,8,8a-hexahydroisoquinoline]-1'-one |
| SMILES | COc1cccc([C@]23CCN(CC4CC4)C(=O)[C@@H]2CCC2(C3)OCCO2)c1 |
| InChI | InChI=1S/C22H29NO4/c1-25-18-4-2-3-17(13-18)21-9-10-23(14-16-5-6-16)20(24)19(21)7-8-22(15-21)26-11-12-27-22/h2-4,13,16,19H,5-12,14-15H2,1H3/t19-,21+/m0/s1 |
| InChIKey | WDVUQFGGNDXRRM-PZJWPPBQSA-N |
| XLogP | 3.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |