C19H21ClN2O4S — CID 1097076
ethyl (3R,5R)-5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate (PubChem CID 1097076) has the molecular formula C19H21ClN2O4S and a molecular weight of 408.91 g/mol. Its IUPAC name is ethyl (3R,5R)-5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate.
| Compound Name | ethyl (3R,5R)-5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 1097076 |
| Molecular Formula | C19H21ClN2O4S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | ethyl (3R,5R)-5-[2-(2-chloroanilino)-1,3-thiazol-4-yl]-3-ethyl-5-methyl-2-oxooxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CC)C[C@](C)(c2csc(Nc3ccccc3Cl)n2)OC1=O |
| InChI | InChI=1S/C19H21ClN2O4S/c1-4-19(15(23)25-5-2)11-18(3,26-16(19)24)14-10-27-17(22-14)21-13-9-7-6-8-12(13)20/h6-10H,4-5,11H2,1-3H3,(H,21,22)/t18-,19-/m1/s1 |
| InChIKey | HKWSHDBAKRETSE-RTBURBONSA-N |
| XLogP | 4.66 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|