C17H28O4Se — CID 10970813
(1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-methylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one (PubChem CID 10970813) has the molecular formula C17H28O4Se and a molecular weight of 375.37 g/mol. Its IUPAC name is (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-methylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one.
| Compound Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-methylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
|---|---|
| PubChem CID | 10970813 |
| Molecular Formula | C17H28O4Se |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | (1R,2S,3R,7S,11E,13S,15S)-2,15-dihydroxy-7-methyl-3-methylselanyl-6-oxabicyclo[11.3.0]hexadec-11-en-5-one |
| SMILES | C[Se][C@@H]1CC(=O)O[C@@H](C)CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@@H]1O |
| InChI | InChI=1S/C17H28O4Se/c1-11-6-4-3-5-7-12-8-13(18)9-14(12)17(20)15(22-2)10-16(19)21-11/h5,7,11-15,17-18,20H,3-4,6,8-10H2,1-2H3/b7-5+/t11-,12+,13-,14+,15+,17-/m0/s1 |
| InChIKey | CCNATFPAWRYEPF-OFOOJMDESA-N |
| XLogP | 2.34 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|