About 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione
1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione (PubChem CID 10970979) has the molecular formula C23H18N4O2
and a molecular weight of 382.42 g/mol. Its IUPAC name is 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione.
Molecular Properties
| Compound Name | 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione |
| PubChem CID | 10970979 |
| Molecular Formula | C23H18N4O2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione |
| SMILES | O=c1c2c(nc3ccccn32)n(Cc2ccccc2)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C23H18N4O2/c28-22-20-21(24-19-13-7-8-14-25(19)20)26(15-17-9-3-1-4-10-17)23(29)27(22)16-18-11-5-2-6-12-18/h1-14H,15-16H2 |
| InChIKey | MRCLOFVOQWMJPM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione?
The IUPAC name of 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione (CID 10970979) is 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione.
What is the SMILES notation for 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione?
The canonical SMILES for 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione is O=c1c2c(nc3ccccn32)n(Cc2ccccc2)c(=O)n1Cc1ccccc1.
What is the InChIKey of 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione?
The InChIKey is MRCLOFVOQWMJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4O2/c28-22-20-21(24-19-13-7-8-14-25(19)20)26(15-17-9-3-1-4-10-17)23(29)27(22)16-18-11-5-2-6-12-18/h1-14H,15-16H2.
What are the key properties of 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione?
1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione has a molecular weight of 382.42 g/mol, XLogP of 2.91, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibenzylpurino[7,8-a]pyridine-2,4-dione is sourced from PubChem (CID 10970979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).