C21H42O4Si — CID 10971091
[(1R,2S,4S)-2-[(Z,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-(methoxymethoxy)cyclopentyl]methanol (PubChem CID 10971091) has the molecular formula C21H42O4Si and a molecular weight of 386.65 g/mol. Its IUPAC name is [(1R,2S,4S)-2-[(Z,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-(methoxymethoxy)cyclopentyl]methanol.
| Compound Name | [(1R,2S,4S)-2-[(Z,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-(methoxymethoxy)cyclopentyl]methanol |
|---|---|
| PubChem CID | 10971091 |
| Molecular Formula | C21H42O4Si |
| Molecular Weight | 386.65 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | [(1R,2S,4S)-2-[(Z,6S)-6-[tert-butyl(dimethyl)silyl]oxyhept-1-enyl]-4-(methoxymethoxy)cyclopentyl]methanol |
| SMILES | COCO[C@@H]1C[C@@H](CO)[C@H](/C=C\CCC[C@H](C)O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H42O4Si/c1-17(25-26(6,7)21(2,3)4)11-9-8-10-12-18-13-20(24-16-23-5)14-19(18)15-22/h10,12,17-20,22H,8-9,11,13-16H2,1-7H3/b12-10-/t17-,18+,19-,20-/m0/s1 |
| InChIKey | PDHWPCAVFWMXQA-VSGNYDIGSA-N |
| XLogP | 5.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|