About (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium
(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium (PubChem CID 10971095) has the molecular formula C14H15INO4+
and a molecular weight of 388.18 g/mol. Its IUPAC name is (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium.
Molecular Properties
| Compound Name | (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium |
| PubChem CID | 10971095 |
| Molecular Formula | C14H15INO4+ |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium |
| SMILES | CC1(C)CC(=O)C([I+]c2ccccc2[N+](=O)[O-])=C(O)C1 |
| InChI | InChI=1S/C14H14INO4/c1-14(2)7-11(17)13(12(18)8-14)15-9-5-3-4-6-10(9)16(19)20/h3-6H,7-8H2,1-2H3/p+1 |
| InChIKey | BWAOPZVYDVJMMR-UHFFFAOYSA-O |
| XLogP | 0.01 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium?
The IUPAC name of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium (CID 10971095) is (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium.
What is the SMILES notation for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium?
The canonical SMILES for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium is CC1(C)CC(=O)C([I+]c2ccccc2[N+](=O)[O-])=C(O)C1.
What is the InChIKey of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium?
The InChIKey is BWAOPZVYDVJMMR-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H14INO4/c1-14(2)7-11(17)13(12(18)8-14)15-9-5-3-4-6-10(9)16(19)20/h3-6H,7-8H2,1-2H3/p+1.
What are the key properties of (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium?
(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium has a molecular weight of 388.18 g/mol, XLogP of 0.01, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)-(2-nitrophenyl)iodanium is sourced from PubChem (CID 10971095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).