C17H25F3O5S — CID 10971343
ethyl (2Z,6E)-7,11-dimethyl-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate (PubChem CID 10971343) has the molecular formula C17H25F3O5S and a molecular weight of 398.44 g/mol. Its IUPAC name is ethyl (2Z,6E)-7,11-dimethyl-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate.
| Compound Name | ethyl (2Z,6E)-7,11-dimethyl-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate |
|---|---|
| PubChem CID | 10971343 |
| Molecular Formula | C17H25F3O5S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | ethyl (2Z,6E)-7,11-dimethyl-3-(trifluoromethylsulfonyloxy)dodeca-2,6,10-trienoate |
| SMILES | CCOC(=O)/C=C(/CC/C=C(\C)CCC=C(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H25F3O5S/c1-5-24-16(21)12-15(25-26(22,23)17(18,19)20)11-7-10-14(4)9-6-8-13(2)3/h8,10,12H,5-7,9,11H2,1-4H3/b14-10+,15-12- |
| InChIKey | SFSGKSYHCVVUHP-DZKMRSEMSA-N |
| XLogP | 4.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|