C22H42O4Si — CID 10971353
(4R)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]-4-[2-(methoxymethoxy)ethyl]-1-methylcyclohex-2-en-1-ol (PubChem CID 10971353) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is (4R)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]-4-[2-(methoxymethoxy)ethyl]-1-methylcyclohex-2-en-1-ol.
| Compound Name | (4R)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]-4-[2-(methoxymethoxy)ethyl]-1-methylcyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 10971353 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | (4R)-4-[(1R,2R)-2-[tert-butyl(dimethyl)silyl]oxy-1-methylcyclobutyl]-4-[2-(methoxymethoxy)ethyl]-1-methylcyclohex-2-en-1-ol |
| SMILES | COCOCC[C@@]1([C@@]2(C)CC[C@H]2O[Si](C)(C)C(C)(C)C)C=CC(C)(O)CC1 |
| InChI | InChI=1S/C22H42O4Si/c1-19(2,3)27(7,8)26-18-9-10-21(18,5)22(15-16-25-17-24-6)13-11-20(4,23)12-14-22/h11,13,18,23H,9-10,12,14-17H2,1-8H3/t18-,20?,21+,22-/m1/s1 |
| InChIKey | ATBMCOWETNBRHC-ANQZQGJXSA-N |
| XLogP | 5.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|